C23H17ClF3N3O3 — CID 118153347
(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(5-fluoro-6-methoxy-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol (PubChem CID 118153347) has the molecular formula C23H17ClF3N3O3 and a molecular weight of 475.85 g/mol. Its IUPAC name is (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(5-fluoro-6-methoxy-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol.
| Compound Name | (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(5-fluoro-6-methoxy-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
|---|---|
| PubChem CID | 118153347 |
| Molecular Formula | C23H17ClF3N3O3 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-11-(5-fluoro-6-methoxy-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
| SMILES | COc1ncc(-c2ccc3nc4c(n3c2)[C@@H](c2cc(Cl)ccc2OC(F)F)C[C@H]4O)cc1F |
| InChI | InChI=1S/C23H17ClF3N3O3/c1-32-22-16(25)6-12(9-28-22)11-2-5-19-29-20-17(31)8-15(21(20)30(19)10-11)14-7-13(24)3-4-18(14)33-23(26)27/h2-7,9-10,15,17,23,31H,8H2,1H3/t15-,17-/m1/s1 |
| InChIKey | RNRQLCHYVRGXLL-NVXWUHKLSA-N |
| XLogP | 5.37 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |