C23H18ClF2N3O3 — CID 118153348
5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1-methylpyridin-2-one (PubChem CID 118153348) has the molecular formula C23H18ClF2N3O3 and a molecular weight of 457.86 g/mol. Its IUPAC name is 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 118153348 |
| Molecular Formula | C23H18ClF2N3O3 |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(-c2ccc3nc4c(n3c2)[C@@H](c2cc(Cl)ccc2OC(F)F)C[C@H]4O)ccc1=O |
| InChI | InChI=1S/C23H18ClF2N3O3/c1-28-10-12(3-7-20(28)31)13-2-6-19-27-21-17(30)9-16(22(21)29(19)11-13)15-8-14(24)4-5-18(15)32-23(25)26/h2-8,10-11,16-17,23,30H,9H2,1H3/t16-,17-/m1/s1 |
| InChIKey | WZEWGCFRLKSFNN-IAGOWNOFSA-N |
| XLogP | 4.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |