C23H18ClFN4O2 — CID 118153433
(3R)-3-(2-chlorophenyl)-10-fluoro-11-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one (PubChem CID 118153433) has the molecular formula C23H18ClFN4O2 and a molecular weight of 436.87 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-10-fluoro-11-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one.
| Compound Name | (3R)-3-(2-chlorophenyl)-10-fluoro-11-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
|---|---|
| PubChem CID | 118153433 |
| Molecular Formula | C23H18ClFN4O2 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-10-fluoro-11-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-one |
| SMILES | CC(C)(O)c1ncc(-c2cn3c4c(nc3cc2F)C(=O)C[C@@H]4c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C23H18ClFN4O2/c1-23(2,31)22-26-9-12(10-27-22)15-11-29-19(8-17(15)25)28-20-18(30)7-14(21(20)29)13-5-3-4-6-16(13)24/h3-6,8-11,14,31H,7H2,1-2H3/t14-/m1/s1 |
| InChIKey | FEVQVOHZHYOLKM-CQSZACIVSA-N |
| XLogP | 4.53 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |