C22H15Cl2F2N3O3 — CID 118153454
6-chloro-5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1H-pyridin-2-one (PubChem CID 118153454) has the molecular formula C22H15Cl2F2N3O3 and a molecular weight of 478.28 g/mol. Its IUPAC name is 6-chloro-5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1H-pyridin-2-one.
| Compound Name | 6-chloro-5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118153454 |
| Molecular Formula | C22H15Cl2F2N3O3 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 6-chloro-5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2ccc3nc4c(n3c2)[C@@H](c2cc(Cl)ccc2OC(F)F)C[C@H]4O)c(Cl)[nH]1 |
| InChI | InChI=1S/C22H15Cl2F2N3O3/c23-11-2-4-16(32-22(25)26)13(7-11)14-8-15(30)19-20(14)29-9-10(1-5-17(29)27-19)12-3-6-18(31)28-21(12)24/h1-7,9,14-15,22,30H,8H2,(H,28,31)/t14-,15-/m1/s1 |
| InChIKey | QQKPKFGQBTWVIX-HUUCEWRRSA-N |
| XLogP | 5.17 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|