C23H18F3N3O4S — CID 118153595
(3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(6-methylsulfonyl-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol (PubChem CID 118153595) has the molecular formula C23H18F3N3O4S and a molecular weight of 489.48 g/mol. Its IUPAC name is (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(6-methylsulfonyl-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol.
| Compound Name | (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(6-methylsulfonyl-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
|---|---|
| PubChem CID | 118153595 |
| Molecular Formula | C23H18F3N3O4S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (3R)-3-[2-(difluoromethoxy)phenyl]-10-fluoro-11-(6-methylsulfonyl-3-pyridinyl)-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-5-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2cn3c4c(nc3cc2F)C(O)C[C@@H]4c2ccccc2OC(F)F)cn1 |
| InChI | InChI=1S/C23H18F3N3O4S/c1-34(31,32)20-7-6-12(10-27-20)15-11-29-19(9-16(15)24)28-21-17(30)8-14(22(21)29)13-4-2-3-5-18(13)33-23(25)26/h2-7,9-11,14,17,23,30H,8H2,1H3/t14-,17?/m1/s1 |
| InChIKey | IDYUFLNFKZCEMN-XPCCGILXSA-N |
| XLogP | 4.11 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |