About (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium
(1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium (PubChem CID 11815420) has the molecular formula C7H11N2O+
and a molecular weight of 139.18 g/mol. Its IUPAC name is (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium.
Molecular Properties
| Compound Name | (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium |
| PubChem CID | 11815420 |
| Molecular Formula | C7H11N2O+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium |
| SMILES | C=C(C)C(C)/C(O)=C/[N+]#N |
| InChI | InChI=1S/C7H10N2O/c1-5(2)6(3)7(10)4-9-8/h4,6H,1H2,2-3H3/p+1/b7-4- |
| InChIKey | ANOKLQWYCVTRKO-DAXSKMNVSA-O |
| XLogP | 2.45 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium?
The IUPAC name of (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium (CID 11815420) is (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium.
What is the SMILES notation for (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium?
The canonical SMILES for (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium is C=C(C)C(C)/C(O)=C/[N+]#N.
What is the InChIKey of (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium?
The InChIKey is ANOKLQWYCVTRKO-DAXSKMNVSA-O. The full InChI is InChI=1S/C7H10N2O/c1-5(2)6(3)7(10)4-9-8/h4,6H,1H2,2-3H3/p+1/b7-4-.
What are the key properties of (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium?
(1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium has a molecular weight of 139.18 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-hydroxy-3,4-dimethylpenta-1,4-diene-1-diazonium is sourced from PubChem (CID 11815420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).