C8H12O2 — CID 11815452
3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 11815452) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | 3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 11815452 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3-methylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | C=C1COC2OCCCC12 |
| InChI | InChI=1S/C8H12O2/c1-6-5-10-8-7(6)3-2-4-9-8/h7-8H,1-5H2 |
| InChIKey | JOTUIXLVJRSCJP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|