C9H15N3O3S2 — CID 118154746
1-ethyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 118154746) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-ethyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118154746 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-ethyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCn1c(=O)n(CCS)c(=O)n(CCS)c1=O |
| InChI | InChI=1S/C9H15N3O3S2/c1-2-10-7(13)11(3-5-16)9(15)12(4-6-17)8(10)14/h16-17H,2-6H2,1H3 |
| InChIKey | WRWZHCHMRLTAMF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|