C53H56N2O — CID 118155098
2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-6-[9-[6-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]pyridine (PubChem CID 118155098) has the molecular formula C53H56N2O and a molecular weight of 743.08 g/mol. Its IUPAC name is 2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-6-[9-[6-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]pyridine.
| Compound Name | 2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-6-[9-[6-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]pyridine |
|---|---|
| PubChem CID | 118155098 |
| Molecular Formula | C53H56N2O |
| Molecular Weight | 743.08 g/mol |
| Exact Mass | 742.48 |
| IUPAC Name | 2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-6-[9-[6-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]pyridine |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1-c1cccc(C3(c4cccc(-c5c([2H])c([2H])c6c(c5[2H])C(C)(C)C(C)(C)C6(C)C)n4)c4ccccc4Oc4ccccc43)n1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C53H56N2O/c1-47(2)35-29-27-33(31-39(35)49(5,6)51(47,9)10)41-21-17-25-45(54-41)53(37-19-13-15-23-43(37)56-44-24-16-14-20-38(44)53)46-26-18-22-42(55-46)34-28-30-36-40(32-34)50(7,8)52(11,12)48(36,3)4/h13-32H,1-12H3/i27D,28D,29D,30D,31D,32D |
| InChIKey | HSURJRYCYUHDEU-UFFMQDAUSA-N |
| XLogP | 13.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.08 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |