About N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide
N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide (PubChem CID 118155165) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide |
| PubChem CID | 118155165 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide |
| SMILES | C/C=C\C(C)=C/C=N/C(C)=O |
| InChI | InChI=1S/C9H13NO/c1-4-5-8(2)6-7-10-9(3)11/h4-7H,1-3H3/b5-4-,8-6-,10-7+ |
| InChIKey | CODCGYGSEVUYRF-QEMWWCGGSA-N |
| XLogP | 2.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide?
The IUPAC name of N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide (CID 118155165) is N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide.
What is the SMILES notation for N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide?
The canonical SMILES for N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide is C/C=C\C(C)=C/C=N/C(C)=O.
What is the InChIKey of N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide?
The InChIKey is CODCGYGSEVUYRF-QEMWWCGGSA-N. The full InChI is InChI=1S/C9H13NO/c1-4-5-8(2)6-7-10-9(3)11/h4-7H,1-3H3/b5-4-,8-6-,10-7+.
What are the key properties of N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide?
N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide has a molecular weight of 151.21 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-3-methylhexa-2,4-dienylidene]acetamide is sourced from PubChem (CID 118155165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).