C19H19ClN4O4 — CID 118155253
ethyl 8-chloro-13-[(4-methoxyphenyl)methyl]-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-5-carboxylate (PubChem CID 118155253) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is ethyl 8-chloro-13-[(4-methoxyphenyl)methyl]-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-5-carboxylate.
| Compound Name | ethyl 8-chloro-13-[(4-methoxyphenyl)methyl]-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 118155253 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | ethyl 8-chloro-13-[(4-methoxyphenyl)methyl]-10-oxa-3,6,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c3c(c(Cl)nn12)OCCN3Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-3-27-19(25)14-10-21-18-15-16(17(20)22-24(14)18)28-9-8-23(15)11-12-4-6-13(26-2)7-5-12/h4-7,10H,3,8-9,11H2,1-2H3 |
| InChIKey | LIJFLNYHHUEUHI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |