C17H24O3 — CID 118155480
(6S,9E,11E,13R)-14-cyclopropyl-6,13-dihydroxytetradeca-9,11-dien-7-yn-3-one (PubChem CID 118155480) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (6S,9E,11E,13R)-14-cyclopropyl-6,13-dihydroxytetradeca-9,11-dien-7-yn-3-one.
| Compound Name | (6S,9E,11E,13R)-14-cyclopropyl-6,13-dihydroxytetradeca-9,11-dien-7-yn-3-one |
|---|---|
| PubChem CID | 118155480 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (6S,9E,11E,13R)-14-cyclopropyl-6,13-dihydroxytetradeca-9,11-dien-7-yn-3-one |
| SMILES | CCC(=O)CC[C@H](O)C#C/C=C/C=C/[C@H](O)CC1CC1 |
| InChI | InChI=1S/C17H24O3/c1-2-15(18)11-12-16(19)7-5-3-4-6-8-17(20)13-14-9-10-14/h3-4,6,8,14,16-17,19-20H,2,9-13H2,1H3/b4-3+,8-6+/t16-,17+/m1/s1 |
| InChIKey | VSAZEDHPKIPGCM-VMDGBFMQSA-N |
| XLogP | 2.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|