C6H7F9N2O4S2 — CID 118155834
1,1,2,2,3,3,4,4,4-nonafluoro-N-(methylaminomethylsulfonyl)butane-1-sulfonamide (PubChem CID 118155834) has the molecular formula C6H7F9N2O4S2 and a molecular weight of 406.25 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(methylaminomethylsulfonyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(methylaminomethylsulfonyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 118155834 |
| Molecular Formula | C6H7F9N2O4S2 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(methylaminomethylsulfonyl)butane-1-sulfonamide |
| SMILES | CNCS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F9N2O4S2/c1-16-2-22(18,19)17-23(20,21)6(14,15)4(9,10)3(7,8)5(11,12)13/h16-17H,2H2,1H3 |
| InChIKey | ZVHKIXBUOZZKCU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|