C20H19BrF2N2O3 — CID 118156353
3-[[(1R,3R)-7-bromo-1-[2-(difluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]oxy]propan-1-ol (PubChem CID 118156353) has the molecular formula C20H19BrF2N2O3 and a molecular weight of 453.28 g/mol. Its IUPAC name is 3-[[(1R,3R)-7-bromo-1-[2-(difluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]oxy]propan-1-ol.
| Compound Name | 3-[[(1R,3R)-7-bromo-1-[2-(difluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 118156353 |
| Molecular Formula | C20H19BrF2N2O3 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 3-[[(1R,3R)-7-bromo-1-[2-(difluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]oxy]propan-1-ol |
| SMILES | OCCCO[C@@H]1C[C@H](c2ccccc2OC(F)F)n2c1nc1ccc(Br)cc12 |
| InChI | InChI=1S/C20H19BrF2N2O3/c21-12-6-7-14-16(10-12)25-15(11-18(19(25)24-14)27-9-3-8-26)13-4-1-2-5-17(13)28-20(22)23/h1-2,4-7,10,15,18,20,26H,3,8-9,11H2/t15-,18-/m1/s1 |
| InChIKey | KPCYGAYDOQRVRK-CRAIPNDOSA-N |
| XLogP | 4.83 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|