About 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one
7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one (PubChem CID 118156450) has the molecular formula C16H11BrN2O
and a molecular weight of 327.18 g/mol. Its IUPAC name is 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one.
Molecular Properties
| Compound Name | 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one |
| PubChem CID | 118156450 |
| Molecular Formula | C16H11BrN2O |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one |
| SMILES | O=C1CC(c2ccccc2)n2c1nc1ccc(Br)cc12 |
| InChI | InChI=1S/C16H11BrN2O/c17-11-6-7-12-14(8-11)19-13(9-15(20)16(19)18-12)10-4-2-1-3-5-10/h1-8,13H,9H2 |
| InChIKey | HKVIOYNQCMZZGF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one?
The IUPAC name of 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one (CID 118156450) is 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one.
What is the SMILES notation for 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one?
The canonical SMILES for 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one is O=C1CC(c2ccccc2)n2c1nc1ccc(Br)cc12.
What is the InChIKey of 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one?
The InChIKey is HKVIOYNQCMZZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN2O/c17-11-6-7-12-14(8-11)19-13(9-15(20)16(19)18-12)10-4-2-1-3-5-10/h1-8,13H,9H2.
What are the key properties of 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one?
7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one has a molecular weight of 327.18 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-phenyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-3-one is sourced from PubChem (CID 118156450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).