About CID 11815671
CID 11815671 (PubChem CID 11815671) has the molecular formula C44H24F24FeOP2+2
and a molecular weight of 1142.42 g/mol.
Molecular Properties
| Compound Name | CID 11815671 |
| PubChem CID | 11815671 |
| Molecular Formula | C44H24F24FeOP2+2 |
| Molecular Weight | 1142.42 g/mol |
| Exact Mass | 1142.03 |
| IUPAC Name | — |
| SMILES | C[C@@H](OP(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C]1[CH][CH][CH][C]1P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C39H19F24OP2.C5H5.Fe/c1-17(64-66(28-13-22(36(52,53)54)7-23(14-28)37(55,56)57)29-15-24(38(58,59)60)8-25(16-29)39(61,62)63)30-3-2-4-31(30)65(26-9-18(32(40,41)42)5-19(10-26)33(43,44)45)27-11-20(34(46,47)48)6-21(12-27)35(49,50)51;1-2-4-5-3-1;/h2-17H,1H3;1-5H;/q;;+2/t17-;;/m1../s1 |
| InChIKey | WVPFNPNQNKJWSM-ZEECNFPPSA-N |
| XLogP | 15.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1142.42 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11815671 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11815671?
The IUPAC name of CID 11815671 (CID 11815671) is not available.
What is the SMILES notation for CID 11815671?
The canonical SMILES for CID 11815671 is C[C@@H](OP(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C]1[CH][CH][CH][C]1P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11815671?
The InChIKey is WVPFNPNQNKJWSM-ZEECNFPPSA-N. The full InChI is InChI=1S/C39H19F24OP2.C5H5.Fe/c1-17(64-66(28-13-22(36(52,53)54)7-23(14-28)37(55,56)57)29-15-24(38(58,59)60)8-25(16-29)39(61,62)63)30-3-2-4-31(30)65(26-9-18(32(40,41)42)5-19(10-26)33(43,44)45)27-11-20(34(46,47)48)6-21(12-27)35(49,50)51;1-2-4-5-3-1;/h2-17H,1H3;1-5H;/q;;+2/t17-;;/m1../s1.
What are the key properties of CID 11815671?
CID 11815671 has a molecular weight of 1142.42 g/mol, XLogP of 15.47, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11815671 is sourced from PubChem (CID 11815671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).