C24H28N2O9S — CID 118156915
6-(5-carboxypentoxy)-2-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]-1,3-benzoxazole-5-sulfonate (PubChem CID 118156915) has the molecular formula C24H28N2O9S and a molecular weight of 520.56 g/mol. Its IUPAC name is 6-(5-carboxypentoxy)-2-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]-1,3-benzoxazole-5-sulfonate.
| Compound Name | 6-(5-carboxypentoxy)-2-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]-1,3-benzoxazole-5-sulfonate |
|---|---|
| PubChem CID | 118156915 |
| Molecular Formula | C24H28N2O9S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 6-(5-carboxypentoxy)-2-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]-1,3-benzoxazole-5-sulfonate |
| SMILES | O=C(O)CCCCCOc1cc2oc(-c3cc[n+](CCCCCC(=O)O)cc3)nc2cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C24H28N2O9S/c27-22(28)7-3-1-5-11-26-12-9-17(10-13-26)24-25-18-15-21(36(31,32)33)20(16-19(18)35-24)34-14-6-2-4-8-23(29)30/h9-10,12-13,15-16H,1-8,11,14H2,(H2-,27,28,29,30,31,32,33) |
| InChIKey | DWRWCJJAOGJUBT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 170.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|