C23H27N2O7S+ — CID 118156952
6-[3-[(E)-2-[6-(3-sulfopropoxy)-1,3-benzoxazol-2-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 118156952) has the molecular formula C23H27N2O7S+ and a molecular weight of 475.54 g/mol. Its IUPAC name is 6-[3-[(E)-2-[6-(3-sulfopropoxy)-1,3-benzoxazol-2-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[3-[(E)-2-[6-(3-sulfopropoxy)-1,3-benzoxazol-2-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 118156952 |
| Molecular Formula | C23H27N2O7S+ |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 6-[3-[(E)-2-[6-(3-sulfopropoxy)-1,3-benzoxazol-2-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCC[n+]1cccc(/C=C/c2nc3ccc(OCCCS(=O)(=O)O)cc3o2)c1 |
| InChI | InChI=1S/C23H26N2O7S/c26-23(27)7-2-1-3-12-25-13-4-6-18(17-25)8-11-22-24-20-10-9-19(16-21(20)32-22)31-14-5-15-33(28,29)30/h4,6,8-11,13,16-17H,1-3,5,7,12,14-15H2,(H-,26,27,28,29,30)/p+1/b11-8+ |
| InChIKey | OMTOYEMGDJMKCY-DHZHZOJOSA-O |
| XLogP | 3.59 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|