About [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol
[2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol (PubChem CID 118157267) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol |
| PubChem CID | 118157267 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol |
| SMILES | OCc1ccnc(-c2nccs2)n1 |
| InChI | InChI=1S/C8H7N3OS/c12-5-6-1-2-9-7(11-6)8-10-3-4-13-8/h1-4,12H,5H2 |
| InChIKey | NHBLSZKAVLRZJK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol?
The IUPAC name of [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol (CID 118157267) is [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol?
The canonical SMILES for [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol is OCc1ccnc(-c2nccs2)n1.
What is the InChIKey of [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol?
The InChIKey is NHBLSZKAVLRZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c12-5-6-1-2-9-7(11-6)8-10-3-4-13-8/h1-4,12H,5H2.
What are the key properties of [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol?
[2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol has a molecular weight of 193.23 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-yl)pyrimidin-4-yl]methanol is sourced from PubChem (CID 118157267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).