About butane-1,1,4-triol
butane-1,1,4-triol (PubChem CID 11815830) has the molecular formula C4H10O3
and a molecular weight of 106.12 g/mol. Its IUPAC name is butane-1,1,4-triol.
Molecular Properties
| Compound Name | butane-1,1,4-triol |
| PubChem CID | 11815830 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | butane-1,1,4-triol |
| SMILES | OCCCC(O)O |
| InChI | InChI=1S/C4H10O3/c5-3-1-2-4(6)7/h4-7H,1-3H2 |
| InChIKey | CLQZEZFINZCXFG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1,4-triol?
The IUPAC name of butane-1,1,4-triol (CID 11815830) is butane-1,1,4-triol.
What is the SMILES notation for butane-1,1,4-triol?
The canonical SMILES for butane-1,1,4-triol is OCCCC(O)O.
What is the InChIKey of butane-1,1,4-triol?
The InChIKey is CLQZEZFINZCXFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3/c5-3-1-2-4(6)7/h4-7H,1-3H2.
What are the key properties of butane-1,1,4-triol?
butane-1,1,4-triol has a molecular weight of 106.12 g/mol, XLogP of -0.93, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1,4-triol is sourced from PubChem (CID 11815830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).