C25H19F3N4O4S — CID 118158500
benzyl 2-[[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]pyridine-3-carboxylate (PubChem CID 118158500) has the molecular formula C25H19F3N4O4S and a molecular weight of 528.51 g/mol. Its IUPAC name is benzyl 2-[[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]pyridine-3-carboxylate.
| Compound Name | benzyl 2-[[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118158500 |
| Molecular Formula | C25H19F3N4O4S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | benzyl 2-[[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]pyridine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cccnc1C(=O)Nc1sc2c(c1-c1nc(C(F)(F)F)no1)CCCC2 |
| InChI | InChI=1S/C25H19F3N4O4S/c26-25(27,28)24-31-21(36-32-24)18-15-9-4-5-11-17(15)37-22(18)30-20(33)19-16(10-6-12-29-19)23(34)35-13-14-7-2-1-3-8-14/h1-3,6-8,10,12H,4-5,9,11,13H2,(H,30,33) |
| InChIKey | VIQZUDQTWACOGV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |