C21H20F3N3O4S — CID 118158559
2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 118158559) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is 2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 118158559 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)Nc2sc3c(c2-c2nc(C4CC4)no2)CCC(C(F)(F)F)C3)CCC1 |
| InChI | InChI=1S/C21H20F3N3O4S/c22-21(23,24)10-6-7-13-14(8-10)32-19(15(13)18-25-16(27-31-18)9-4-5-9)26-17(28)11-2-1-3-12(11)20(29)30/h9-10H,1-8H2,(H,26,28)(H,29,30) |
| InChIKey | DMWSWRDYCNCKOL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |