About 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile
2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile (PubChem CID 118158770) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile |
| PubChem CID | 118158770 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile |
| SMILES | Cc1nc(C(C#N)=C2CCOCC2)sc1C |
| InChI | InChI=1S/C12H14N2OS/c1-8-9(2)16-12(14-8)11(7-13)10-3-5-15-6-4-10/h3-6H2,1-2H3 |
| InChIKey | JTPJIDVYPDMBHT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile?
The IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile (CID 118158770) is 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile.
What is the SMILES notation for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile?
The canonical SMILES for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile is Cc1nc(C(C#N)=C2CCOCC2)sc1C.
What is the InChIKey of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile?
The InChIKey is JTPJIDVYPDMBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-8-9(2)16-12(14-8)11(7-13)10-3-5-15-6-4-10/h3-6H2,1-2H3.
What are the key properties of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile?
2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile has a molecular weight of 234.32 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(oxan-4-ylidene)acetonitrile is sourced from PubChem (CID 118158770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).