About 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide
6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (PubChem CID 118158983) has the molecular formula C21H18ClN3O
and a molecular weight of 363.85 g/mol. Its IUPAC name is 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| PubChem CID | 118158983 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| SMILES | CN1c2ccc(Cl)cc2CCc2cc(-c3cccc(C(N)=O)n3)ccc21 |
| InChI | InChI=1S/C21H18ClN3O/c1-25-19-9-7-13(17-3-2-4-18(24-17)21(23)26)11-14(19)5-6-15-12-16(22)8-10-20(15)25/h2-4,7-12H,5-6H2,1H3,(H2,23,26) |
| InChIKey | NOHUFCHXXKZLQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The IUPAC name of 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (CID 118158983) is 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
What is the SMILES notation for 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The canonical SMILES for 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is CN1c2ccc(Cl)cc2CCc2cc(-c3cccc(C(N)=O)n3)ccc21.
What is the InChIKey of 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The InChIKey is NOHUFCHXXKZLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O/c1-25-19-9-7-13(17-3-2-4-18(24-17)21(23)26)11-14(19)5-6-15-12-16(22)8-10-20(15)25/h2-4,7-12H,5-6H2,1H3,(H2,23,26).
What are the key properties of 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide has a molecular weight of 363.85 g/mol, XLogP of 4.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloro-11-methyl-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is sourced from PubChem (CID 118158983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).