About 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide
6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (PubChem CID 118158996) has the molecular formula C20H16ClN3O
and a molecular weight of 349.82 g/mol. Its IUPAC name is 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| PubChem CID | 118158996 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc(-c2ccc3c(c2)CCc2cc(Cl)ccc2N3)n1 |
| InChI | InChI=1S/C20H16ClN3O/c21-15-7-9-18-14(11-15)5-4-12-10-13(6-8-17(12)23-18)16-2-1-3-19(24-16)20(22)25/h1-3,6-11,23H,4-5H2,(H2,22,25) |
| InChIKey | DHGZFNINOOBXHZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The IUPAC name of 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (CID 118158996) is 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
What is the SMILES notation for 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The canonical SMILES for 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is NC(=O)c1cccc(-c2ccc3c(c2)CCc2cc(Cl)ccc2N3)n1.
What is the InChIKey of 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The InChIKey is DHGZFNINOOBXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O/c21-15-7-9-18-14(11-15)5-4-12-10-13(6-8-17(12)23-18)16-2-1-3-19(24-16)20(22)25/h1-3,6-11,23H,4-5H2,(H2,22,25).
What are the key properties of 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide has a molecular weight of 349.82 g/mol, XLogP of 4.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloro-6,11-dihydro-5H-benzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is sourced from PubChem (CID 118158996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).