About 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide
6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (PubChem CID 118158998) has the molecular formula C22H18ClN3O2
and a molecular weight of 391.86 g/mol. Its IUPAC name is 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| PubChem CID | 118158998 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide |
| SMILES | CC(=O)N1c2ccc(Cl)cc2CCc2cc(-c3cccc(C(N)=O)n3)ccc21 |
| InChI | InChI=1S/C22H18ClN3O2/c1-13(27)26-20-9-7-14(18-3-2-4-19(25-18)22(24)28)11-15(20)5-6-16-12-17(23)8-10-21(16)26/h2-4,7-12H,5-6H2,1H3,(H2,24,28) |
| InChIKey | DQZCKKLCUPMNHN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The IUPAC name of 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide (CID 118158998) is 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide.
What is the SMILES notation for 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The canonical SMILES for 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is CC(=O)N1c2ccc(Cl)cc2CCc2cc(-c3cccc(C(N)=O)n3)ccc21.
What is the InChIKey of 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
The InChIKey is DQZCKKLCUPMNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClN3O2/c1-13(27)26-20-9-7-14(18-3-2-4-19(25-18)22(24)28)11-15(20)5-6-16-12-17(23)8-10-21(16)26/h2-4,7-12H,5-6H2,1H3,(H2,24,28).
What are the key properties of 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide?
6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide has a molecular weight of 391.86 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(11-acetyl-3-chloro-5,6-dihydrobenzo[b][1]benzazepin-8-yl)pyridine-2-carboxamide is sourced from PubChem (CID 118158998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).