C20H23F4N5O — CID 118159369
N-(2,2-difluoroethyl)-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-3-amine (PubChem CID 118159369) has the molecular formula C20H23F4N5O and a molecular weight of 425.43 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 118159369 |
| Molecular Formula | C20H23F4N5O |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-3-amine |
| SMILES | Fc1ccc(OC2CCN(c3nc4c(nc3NCC(F)F)CNCC4)CC2)c(F)c1 |
| InChI | InChI=1S/C20H23F4N5O/c21-12-1-2-17(14(22)9-12)30-13-4-7-29(8-5-13)20-19(26-11-18(23)24)27-16-10-25-6-3-15(16)28-20/h1-2,9,13,18,25H,3-8,10-11H2,(H,26,27) |
| InChIKey | ANHQHUJBJUZJPG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |