C22H28N6 — CID 118159456
N-(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 118159456) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is N-(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118159456 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cc2c(cc(NCCCN(C)C)c3nnc(C)n32)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N6/c1-16-13-21-20(27(16)15-18-9-6-5-7-10-18)14-19(23-11-8-12-26(3)4)22-25-24-17(2)28(21)22/h5-7,9-10,13-14,23H,8,11-12,15H2,1-4H3 |
| InChIKey | NUOLKGIRRVXGFV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|