C24H24ClN7O — CID 118159517
3-[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]pyrazol-1-yl]-N-ethylpropanamide (PubChem CID 118159517) has the molecular formula C24H24ClN7O and a molecular weight of 461.96 g/mol. Its IUPAC name is 3-[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]pyrazol-1-yl]-N-ethylpropanamide.
| Compound Name | 3-[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]pyrazol-1-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 118159517 |
| Molecular Formula | C24H24ClN7O |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]pyrazol-1-yl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1ccc(-c2cc3c(ccc4nnc(C)n43)n2Cc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C24H24ClN7O/c1-3-26-24(33)10-12-30-11-9-19(29-30)21-14-22-20(7-8-23-28-27-16(2)32(22)23)31(21)15-17-5-4-6-18(25)13-17/h4-9,11,13-14H,3,10,12,15H2,1-2H3,(H,26,33) |
| InChIKey | DLEDNTBWJVLGCF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |