C18H19N5 — CID 118159549
5-benzyl-N,4,12-trimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine (PubChem CID 118159549) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-benzyl-N,4,12-trimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine.
| Compound Name | 5-benzyl-N,4,12-trimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 118159549 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 5-benzyl-N,4,12-trimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
| SMILES | CNc1cc2c(cc(C)n2Cc2ccccc2)n2c(C)nnc12 |
| InChI | InChI=1S/C18H19N5/c1-12-9-17-16(22(12)11-14-7-5-4-6-8-14)10-15(19-3)18-21-20-13(2)23(17)18/h4-10,19H,11H2,1-3H3 |
| InChIKey | GFERVXOJIQLMQT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |