C20H17F3N4O2 — CID 118159568
[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methyl 2,2,2-trifluoroacetate (PubChem CID 118159568) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118159568 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)methyl]phenyl]methyl 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(ccc3nnc(C)n32)n1Cc1cccc(COC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F3N4O2/c1-12-8-17-16(6-7-18-25-24-13(2)27(17)18)26(12)10-14-4-3-5-15(9-14)11-29-19(28)20(21,22)23/h3-9H,10-11H2,1-2H3 |
| InChIKey | WTSARLPOMLVNQP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |