C19H21N5 — CID 118159588
5-benzyl-N-ethyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine (PubChem CID 118159588) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-benzyl-N-ethyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine.
| Compound Name | 5-benzyl-N-ethyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 118159588 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-benzyl-N-ethyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
| SMILES | CCNc1cc2c(cc(C)n2Cc2ccccc2)n2c(C)nnc12 |
| InChI | InChI=1S/C19H21N5/c1-4-20-16-11-17-18(24-14(3)21-22-19(16)24)10-13(2)23(17)12-15-8-6-5-7-9-15/h5-11,20H,4,12H2,1-3H3 |
| InChIKey | PRIUQKUURUZTDK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |