C24H25N7O — CID 118159591
3-[3-(5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl)pyrazol-1-yl]-N-ethylpropanamide (PubChem CID 118159591) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-[3-(5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl)pyrazol-1-yl]-N-ethylpropanamide.
| Compound Name | 3-[3-(5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl)pyrazol-1-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 118159591 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 3-[3-(5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl)pyrazol-1-yl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1ccc(-c2cc3c(ccc4nnc(C)n43)n2Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H25N7O/c1-3-25-24(32)12-14-29-13-11-19(28-29)21-15-22-20(9-10-23-27-26-17(2)31(22)23)30(21)16-18-7-5-4-6-8-18/h4-11,13,15H,3,12,14,16H2,1-2H3,(H,25,32) |
| InChIKey | VXRYXAADYWBITO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |