C20H16N4S — CID 118159609
5-benzyl-12-methyl-4-thiophen-2-yl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 118159609) has the molecular formula C20H16N4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-benzyl-12-methyl-4-thiophen-2-yl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-benzyl-12-methyl-4-thiophen-2-yl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 118159609 |
| Molecular Formula | C20H16N4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-benzyl-12-methyl-4-thiophen-2-yl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1nnc2ccc3c(cc(-c4cccs4)n3Cc3ccccc3)n12 |
| InChI | InChI=1S/C20H16N4S/c1-14-21-22-20-10-9-16-17(24(14)20)12-18(19-8-5-11-25-19)23(16)13-15-6-3-2-4-7-15/h2-12H,13H2,1H3 |
| InChIKey | YXMDMQVBJXVXDT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |