About 1-butyl-1,2-diethylcyclopropane
1-butyl-1,2-diethylcyclopropane (PubChem CID 11815966) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 1-butyl-1,2-diethylcyclopropane.
Molecular Properties
| Compound Name | 1-butyl-1,2-diethylcyclopropane |
| PubChem CID | 11815966 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1-butyl-1,2-diethylcyclopropane |
| SMILES | CCCCC1(CC)CC1CC |
| InChI | InChI=1S/C11H22/c1-4-7-8-11(6-3)9-10(11)5-2/h10H,4-9H2,1-3H3 |
| InChIKey | OZSBHQBEMYEBLD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-1,2-diethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1,2-diethylcyclopropane?
The IUPAC name of 1-butyl-1,2-diethylcyclopropane (CID 11815966) is 1-butyl-1,2-diethylcyclopropane.
What is the SMILES notation for 1-butyl-1,2-diethylcyclopropane?
The canonical SMILES for 1-butyl-1,2-diethylcyclopropane is CCCCC1(CC)CC1CC.
What is the InChIKey of 1-butyl-1,2-diethylcyclopropane?
The InChIKey is OZSBHQBEMYEBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-4-7-8-11(6-3)9-10(11)5-2/h10H,4-9H2,1-3H3.
What are the key properties of 1-butyl-1,2-diethylcyclopropane?
1-butyl-1,2-diethylcyclopropane has a molecular weight of 154.30 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1,2-diethylcyclopropane is sourced from PubChem (CID 11815966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).