C17H15FN4 — CID 118159711
5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 118159711) has the molecular formula C17H15FN4 and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 118159711 |
| Molecular Formula | C17H15FN4 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1cc2c(ccc3nnc(C)n32)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN4/c1-11-9-16-15(7-8-17-20-19-12(2)22(16)17)21(11)10-13-3-5-14(18)6-4-13/h3-9H,10H2,1-2H3 |
| InChIKey | XXNGRHUJXBGTSV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |