C20H19N7 — CID 118159782
5-benzyl-N-(1H-imidazol-2-yl)-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine (PubChem CID 118159782) has the molecular formula C20H19N7 and a molecular weight of 357.42 g/mol. Its IUPAC name is 5-benzyl-N-(1H-imidazol-2-yl)-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine.
| Compound Name | 5-benzyl-N-(1H-imidazol-2-yl)-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 118159782 |
| Molecular Formula | C20H19N7 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-benzyl-N-(1H-imidazol-2-yl)-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
| SMILES | Cc1cc2c(cc(Nc3ncc[nH]3)c3nnc(C)n32)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H19N7/c1-13-10-18-17(26(13)12-15-6-4-3-5-7-15)11-16(23-20-21-8-9-22-20)19-25-24-14(2)27(18)19/h3-11H,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | HMUHGXURPQNVEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |