C24H26N6 — CID 118159784
4-[(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)amino]cyclohexane-1-carbonitrile (PubChem CID 118159784) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)amino]cyclohexane-1-carbonitrile.
| Compound Name | 4-[(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)amino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 118159784 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4-[(5-benzyl-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl)amino]cyclohexane-1-carbonitrile |
| SMILES | Cc1cc2c(cc(NC3CCC(C#N)CC3)c3nnc(C)n32)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N6/c1-16-12-23-22(29(16)15-19-6-4-3-5-7-19)13-21(24-28-27-17(2)30(23)24)26-20-10-8-18(14-25)9-11-20/h3-7,12-13,18,20,26H,8-11,15H2,1-2H3 |
| InChIKey | VHHGNLHSKZGTJJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |