C25H40O6 — CID 118159865
[17-(2-hydroxyacetyl)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 118159865) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [17-(2-hydroxyacetyl)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [17-(2-hydroxyacetyl)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 118159865 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [17-(2-hydroxyacetyl)-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | COCOC1CCC2(C)C(CCC3C4CCC(C(=O)CO)C4(C)CC(OC(C)=O)C32)C1 |
| InChI | InChI=1S/C25H40O6/c1-15(27)31-22-12-25(3)19(7-8-20(25)21(28)13-26)18-6-5-16-11-17(30-14-29-4)9-10-24(16,2)23(18)22/h16-20,22-23,26H,5-14H2,1-4H3 |
| InChIKey | XOKXFLKDQVZRCC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|