C22H27F2NO4S — CID 118160071
5-[3-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118160071) has the molecular formula C22H27F2NO4S and a molecular weight of 439.52 g/mol. Its IUPAC name is 5-[3-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118160071 |
| Molecular Formula | C22H27F2NO4S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 5-[3-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCC#CCC(C)[C@@H](O)C=C[C@H]1CC(F)(F)C(=O)N1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C22H27F2NO4S/c1-3-4-5-7-15(2)18(26)11-9-16-14-22(23,24)21(29)25(16)13-6-8-17-10-12-19(30-17)20(27)28/h9-12,15-16,18,26H,3,6-8,13-14H2,1-2H3,(H,27,28)/t15?,16-,18-/m0/s1 |
| InChIKey | UMYXRXWDPHAKGZ-YLGOGADGSA-N |
| XLogP | 3.97 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|