C8H16O3 — CID 11816010
(2S,3R,4S)-2-prop-1-en-2-ylpentane-1,3,4-triol (PubChem CID 11816010) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2S,3R,4S)-2-prop-1-en-2-ylpentane-1,3,4-triol.
| Compound Name | (2S,3R,4S)-2-prop-1-en-2-ylpentane-1,3,4-triol |
|---|---|
| PubChem CID | 11816010 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2S,3R,4S)-2-prop-1-en-2-ylpentane-1,3,4-triol |
| SMILES | C=C(C)[C@@H](CO)[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C8H16O3/c1-5(2)7(4-9)8(11)6(3)10/h6-11H,1,4H2,2-3H3/t6-,7+,8-/m0/s1 |
| InChIKey | BQCLXLJQFGUVOX-RNJXMRFFSA-N |
| XLogP | -0.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|