C25H34ClF2NO4 — CID 118160184
7-[(5R)-5-[(3R,4S)-7-(3-chlorophenyl)-3-hydroxy-4-methylhept-1-enyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 118160184) has the molecular formula C25H34ClF2NO4 and a molecular weight of 486.00 g/mol. Its IUPAC name is 7-[(5R)-5-[(3R,4S)-7-(3-chlorophenyl)-3-hydroxy-4-methylhept-1-enyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-5-[(3R,4S)-7-(3-chlorophenyl)-3-hydroxy-4-methylhept-1-enyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 118160184 |
| Molecular Formula | C25H34ClF2NO4 |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 7-[(5R)-5-[(3R,4S)-7-(3-chlorophenyl)-3-hydroxy-4-methylhept-1-enyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | C[C@@H](CCCc1cccc(Cl)c1)[C@@H](O)C=C[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H34ClF2NO4/c1-18(8-6-9-19-10-7-11-20(26)16-19)22(30)14-13-21-17-25(27,28)24(33)29(21)15-5-3-2-4-12-23(31)32/h7,10-11,13-14,16,18,21-22,30H,2-6,8-9,12,15,17H2,1H3,(H,31,32)/t18-,21-,22-/m0/s1 |
| InChIKey | KTXRWMUFYLWPKC-NYVOZVTQSA-N |
| XLogP | 5.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|