About 6-methoxyindol-1-amine
6-methoxyindol-1-amine (PubChem CID 11816030) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-methoxyindol-1-amine.
Molecular Properties
| Compound Name | 6-methoxyindol-1-amine |
| PubChem CID | 11816030 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 6-methoxyindol-1-amine |
| SMILES | COc1ccc2ccn(N)c2c1 |
| InChI | InChI=1S/C9H10N2O/c1-12-8-3-2-7-4-5-11(10)9(7)6-8/h2-6H,10H2,1H3 |
| InChIKey | SJQLWYYPWQJPBS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxyindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyindol-1-amine?
The IUPAC name of 6-methoxyindol-1-amine (CID 11816030) is 6-methoxyindol-1-amine.
What is the SMILES notation for 6-methoxyindol-1-amine?
The canonical SMILES for 6-methoxyindol-1-amine is COc1ccc2ccn(N)c2c1.
What is the InChIKey of 6-methoxyindol-1-amine?
The InChIKey is SJQLWYYPWQJPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-12-8-3-2-7-4-5-11(10)9(7)6-8/h2-6H,10H2,1H3.
What are the key properties of 6-methoxyindol-1-amine?
6-methoxyindol-1-amine has a molecular weight of 162.19 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyindol-1-amine is sourced from PubChem (CID 11816030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).