About 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid
7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 118160306) has the molecular formula C19H31F2NO4
and a molecular weight of 375.46 g/mol. Its IUPAC name is 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| PubChem CID | 118160306 |
| Molecular Formula | C19H31F2NO4 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CCCCC[C@@H](O)C=C[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H31F2NO4/c1-2-3-6-9-16(23)12-11-15-14-19(20,21)18(26)22(15)13-8-5-4-7-10-17(24)25/h11-12,15-16,23H,2-10,13-14H2,1H3,(H,24,25)/t15-,16+/m0/s1 |
| InChIKey | PWZMQIUUWBQDQW-JKSUJKDBSA-N |
| XLogP | 3.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The IUPAC name of 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid (CID 118160306) is 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
What is the SMILES notation for 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The canonical SMILES for 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid is CCCCC[C@@H](O)C=C[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)O.
What is the InChIKey of 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The InChIKey is PWZMQIUUWBQDQW-JKSUJKDBSA-N. The full InChI is InChI=1S/C19H31F2NO4/c1-2-3-6-9-16(23)12-11-15-14-19(20,21)18(26)22(15)13-8-5-4-7-10-17(24)25/h11-12,15-16,23H,2-10,13-14H2,1H3,(H,24,25)/t15-,16+/m0/s1.
What are the key properties of 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid has a molecular weight of 375.46 g/mol, XLogP of 3.76, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5R)-3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid is sourced from PubChem (CID 118160306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).