C14H14IN3 — CID 118160856
4-cyclopropyl-N-(3-iodo-5-methylphenyl)pyrimidin-2-amine (PubChem CID 118160856) has the molecular formula C14H14IN3 and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-cyclopropyl-N-(3-iodo-5-methylphenyl)pyrimidin-2-amine.
| Compound Name | 4-cyclopropyl-N-(3-iodo-5-methylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118160856 |
| Molecular Formula | C14H14IN3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-cyclopropyl-N-(3-iodo-5-methylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(I)cc(Nc2nccc(C3CC3)n2)c1 |
| InChI | InChI=1S/C14H14IN3/c1-9-6-11(15)8-12(7-9)17-14-16-5-4-13(18-14)10-2-3-10/h4-8,10H,2-3H2,1H3,(H,16,17,18) |
| InChIKey | HKKZOSPGWCICMB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|