About 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one
1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one (PubChem CID 11816089) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one.
Molecular Properties
| Compound Name | 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one |
| PubChem CID | 11816089 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)C1OC1(C)C |
| InChI | InChI=1S/C10H16O2/c1-6-9(2,3)7(11)8-10(4,5)12-8/h6,8H,1H2,2-5H3 |
| InChIKey | VDWHYKNCKVKWIG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one?
The IUPAC name of 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one (CID 11816089) is 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one.
What is the SMILES notation for 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one?
The canonical SMILES for 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one is C=CC(C)(C)C(=O)C1OC1(C)C.
What is the InChIKey of 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one?
The InChIKey is VDWHYKNCKVKWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-6-9(2,3)7(11)8-10(4,5)12-8/h6,8H,1H2,2-5H3.
What are the key properties of 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one?
1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one has a molecular weight of 168.24 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyloxiran-2-yl)-2,2-dimethylbut-3-en-1-one is sourced from PubChem (CID 11816089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).