C22H24N8O2 — CID 118161075
[(2R)-4-[4-[[6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol (PubChem CID 118161075) has the molecular formula C22H24N8O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is [(2R)-4-[4-[[6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol.
| Compound Name | [(2R)-4-[4-[[6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 118161075 |
| Molecular Formula | C22H24N8O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(2R)-4-[4-[[6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol |
| SMILES | Cc1ncc(-c2cn3ccnc3c(Nc3ccc(N4CCO[C@@H](CO)C4)cc3)n2)nc1N |
| InChI | InChI=1S/C22H24N8O2/c1-14-20(23)27-18(10-25-14)19-12-30-7-6-24-22(30)21(28-19)26-15-2-4-16(5-3-15)29-8-9-32-17(11-29)13-31/h2-7,10,12,17,31H,8-9,11,13H2,1H3,(H2,23,27)(H,26,28)/t17-/m1/s1 |
| InChIKey | ZNTHWWPFKRIXOD-QGZVFWFLSA-N |
| XLogP | 2.02 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|