C8H12FNO2 — CID 11816138
6-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 11816138) has the molecular formula C8H12FNO2 and a molecular weight of 173.19 g/mol. Its IUPAC name is 6-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 6-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 11816138 |
| Molecular Formula | C8H12FNO2 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 6-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1NCC2C(F)CCC12 |
| InChI | InChI=1S/C8H12FNO2/c9-6-2-1-4-5(6)3-10-7(4)8(11)12/h4-7,10H,1-3H2,(H,11,12) |
| InChIKey | SDBDCXZGHJRRNP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |