About 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole
5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole (PubChem CID 118161569) has the molecular formula C12H16FIN2
and a molecular weight of 334.18 g/mol. Its IUPAC name is 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole |
| PubChem CID | 118161569 |
| Molecular Formula | C12H16FIN2 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole |
| SMILES | CC(C)n1nc(I)cc1C1[C@H]2CC(F)C[C@@H]12 |
| InChI | InChI=1S/C12H16FIN2/c1-6(2)16-10(5-11(14)15-16)12-8-3-7(13)4-9(8)12/h5-9,12H,3-4H2,1-2H3/t7?,8-,9+,12? |
| InChIKey | CJJKSNRBBLTDRN-UVSREPBJSA-N |
| XLogP | 3.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The IUPAC name of 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole (CID 118161569) is 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole.
What is the SMILES notation for 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The canonical SMILES for 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole is CC(C)n1nc(I)cc1C1[C@H]2CC(F)C[C@@H]12.
What is the InChIKey of 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The InChIKey is CJJKSNRBBLTDRN-UVSREPBJSA-N. The full InChI is InChI=1S/C12H16FIN2/c1-6(2)16-10(5-11(14)15-16)12-8-3-7(13)4-9(8)12/h5-9,12H,3-4H2,1-2H3/t7?,8-,9+,12?.
What are the key properties of 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole has a molecular weight of 334.18 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,5R)-3-fluoro-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole is sourced from PubChem (CID 118161569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).