C16H19F6IN2O6S2 — CID 118161602
[(1R,5S)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-(trifluoromethylsulfonyloxymethyl)-3-bicyclo[3.1.0]hexanyl]methyl trifluoromethanesulfonate (PubChem CID 118161602) has the molecular formula C16H19F6IN2O6S2 and a molecular weight of 640.36 g/mol. Its IUPAC name is [(1R,5S)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-(trifluoromethylsulfonyloxymethyl)-3-bicyclo[3.1.0]hexanyl]methyl trifluoromethanesulfonate.
| Compound Name | [(1R,5S)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-(trifluoromethylsulfonyloxymethyl)-3-bicyclo[3.1.0]hexanyl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118161602 |
| Molecular Formula | C16H19F6IN2O6S2 |
| Molecular Weight | 640.36 g/mol |
| Exact Mass | 639.96 |
| IUPAC Name | [(1R,5S)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-(trifluoromethylsulfonyloxymethyl)-3-bicyclo[3.1.0]hexanyl]methyl trifluoromethanesulfonate |
| SMILES | CC(C)n1nc(I)cc1C1[C@H]2CC(COS(=O)(=O)C(F)(F)F)(COS(=O)(=O)C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C16H19F6IN2O6S2/c1-8(2)25-11(3-12(23)24-25)13-9-4-14(5-10(9)13,6-30-32(26,27)15(17,18)19)7-31-33(28,29)16(20,21)22/h3,8-10,13H,4-7H2,1-2H3/t9-,10+,13? |
| InChIKey | FGUWKYPMVBKKCA-HWYHXSKPSA-N |
| XLogP | 3.91 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|